About methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate
methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate (PubChem CID 46881910) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate |
| PubChem CID | 46881910 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C13H15NO3/c1-9-5-4-6-10(2)13(9)14-11(15)7-8-12(16)17-3/h4-8H,1-3H3,(H,14,15)/b8-7+ |
| InChIKey | FYOMGRJFXLZDTA-BQYQJAHWSA-N |
| XLogP | 1.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate?
The IUPAC name of methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate (CID 46881910) is methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate.
What is the SMILES notation for methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate?
The canonical SMILES for methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate is COC(=O)/C=C/C(=O)Nc1c(C)cccc1C.
What is the InChIKey of methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate?
The InChIKey is FYOMGRJFXLZDTA-BQYQJAHWSA-N. The full InChI is InChI=1S/C13H15NO3/c1-9-5-4-6-10(2)13(9)14-11(15)7-8-12(16)17-3/h4-8H,1-3H3,(H,14,15)/b8-7+.
What are the key properties of methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate?
methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate has a molecular weight of 233.27 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoate is sourced from PubChem (CID 46881910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).