C20H23NO2 — CID 46881943
2-[(4aS,5R,10bS)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-yl]ethanol (PubChem CID 46881943) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[(4aS,5R,10bS)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-yl]ethanol.
| Compound Name | 2-[(4aS,5R,10bS)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-yl]ethanol |
|---|---|
| PubChem CID | 46881943 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-[(4aS,5R,10bS)-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-yl]ethanol |
| SMILES | OCCc1ccc2c(c1)[C@H]1OCCC[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C20H23NO2/c22-11-10-14-8-9-18-17(13-14)20-16(7-4-12-23-20)19(21-18)15-5-2-1-3-6-15/h1-3,5-6,8-9,13,16,19-22H,4,7,10-12H2/t16-,19-,20-/m0/s1 |
| InChIKey | VCYDJZNSGMTMMC-VDGAXYAQSA-N |
| XLogP | 3.86 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |