C31H34F2N4O2 — CID 46881965
benzyl N-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]butyl]-N-(cyanomethyl)carbamate (PubChem CID 46881965) has the molecular formula C31H34F2N4O2 and a molecular weight of 532.64 g/mol. Its IUPAC name is benzyl N-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]butyl]-N-(cyanomethyl)carbamate.
| Compound Name | benzyl N-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]butyl]-N-(cyanomethyl)carbamate |
|---|---|
| PubChem CID | 46881965 |
| Molecular Formula | C31H34F2N4O2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | benzyl N-[4-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]butyl]-N-(cyanomethyl)carbamate |
| SMILES | N#CCN(CCCCN1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H34F2N4O2/c32-28-12-8-26(9-13-28)30(27-10-14-29(33)15-11-27)36-22-20-35(21-23-36)17-4-5-18-37(19-16-34)31(38)39-24-25-6-2-1-3-7-25/h1-3,6-15,30H,4-5,17-24H2 |
| InChIKey | KBDYJFNXFJPZLV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|