About 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine
4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine (PubChem CID 46881970) has the molecular formula C17H27N5
and a molecular weight of 301.44 g/mol. Its IUPAC name is 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine.
Molecular Properties
| Compound Name | 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine |
| PubChem CID | 46881970 |
| Molecular Formula | C17H27N5 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine |
| SMILES | Nc1nc(N2CCNCC2)c2c(n1)C1(CCCCC1)CCC2 |
| InChI | InChI=1S/C17H27N5/c18-16-20-14-13(15(21-16)22-11-9-19-10-12-22)5-4-8-17(14)6-2-1-3-7-17/h19H,1-12H2,(H2,18,20,21) |
| InChIKey | IBHXJPGHTAGSCB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine?
The IUPAC name of 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine (CID 46881970) is 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine.
What is the SMILES notation for 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine?
The canonical SMILES for 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine is Nc1nc(N2CCNCC2)c2c(n1)C1(CCCCC1)CCC2.
What is the InChIKey of 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine?
The InChIKey is IBHXJPGHTAGSCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N5/c18-16-20-14-13(15(21-16)22-11-9-19-10-12-22)5-4-8-17(14)6-2-1-3-7-17/h19H,1-12H2,(H2,18,20,21).
What are the key properties of 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine?
4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine has a molecular weight of 301.44 g/mol, XLogP of 2.01, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-ylspiro[6,7-dihydro-5H-quinazoline-8,1'-cyclohexane]-2-amine is sourced from PubChem (CID 46881970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).