C21H26N4O4S — CID 46882015
benzyl N-[(E,3S)-1-(benzenesulfonyl)-6-(diaminomethylideneamino)hex-1-en-3-yl]carbamate (PubChem CID 46882015) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is benzyl N-[(E,3S)-1-(benzenesulfonyl)-6-(diaminomethylideneamino)hex-1-en-3-yl]carbamate.
| Compound Name | benzyl N-[(E,3S)-1-(benzenesulfonyl)-6-(diaminomethylideneamino)hex-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 46882015 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | benzyl N-[(E,3S)-1-(benzenesulfonyl)-6-(diaminomethylideneamino)hex-1-en-3-yl]carbamate |
| SMILES | NC(N)=NCCC[C@@H](/C=C/S(=O)(=O)c1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H26N4O4S/c22-20(23)24-14-7-10-18(13-15-30(27,28)19-11-5-2-6-12-19)25-21(26)29-16-17-8-3-1-4-9-17/h1-6,8-9,11-13,15,18H,7,10,14,16H2,(H,25,26)(H4,22,23,24)/b15-13+/t18-/m0/s1 |
| InChIKey | BIGBADKFHAJMCP-DUVHGLKDSA-N |
| XLogP | 2.32 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|