C29H29N3O3 — CID 46882028
N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-(phenoxymethyl)benzamide (PubChem CID 46882028) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-(phenoxymethyl)benzamide.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 46882028 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-(phenoxymethyl)benzamide |
| SMILES | O=C(Nc1ccc(CCNC[C@H](O)c2cccnc2)cc1)c1ccccc1COc1ccccc1 |
| InChI | InChI=1S/C29H29N3O3/c33-28(23-8-6-17-30-19-23)20-31-18-16-22-12-14-25(15-13-22)32-29(34)27-11-5-4-7-24(27)21-35-26-9-2-1-3-10-26/h1-15,17,19,28,31,33H,16,18,20-21H2,(H,32,34)/t28-/m0/s1 |
| InChIKey | HIIVUZRNMMABGG-NDEPHWFRSA-N |
| XLogP | 4.78 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|