C14H11N5 — CID 46882056
3,6-diamino-4-phenyl-1H-indazole-5-carbonitrile (PubChem CID 46882056) has the molecular formula C14H11N5 and a molecular weight of 249.28 g/mol. Its IUPAC name is 3,6-diamino-4-phenyl-1H-indazole-5-carbonitrile.
| Compound Name | 3,6-diamino-4-phenyl-1H-indazole-5-carbonitrile |
|---|---|
| PubChem CID | 46882056 |
| Molecular Formula | C14H11N5 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3,6-diamino-4-phenyl-1H-indazole-5-carbonitrile |
| SMILES | N#Cc1c(N)cc2[nH]nc(N)c2c1-c1ccccc1 |
| InChI | InChI=1S/C14H11N5/c15-7-9-10(16)6-11-13(14(17)19-18-11)12(9)8-4-2-1-3-5-8/h1-6H,16H2,(H3,17,18,19) |
| InChIKey | LMFRJXHSGGPLGI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|