C24H20N2O2 — CID 46882061
2-[4-[2-(5-phenyl-1H-imidazol-2-yl)ethyl]phenyl]benzoic acid (PubChem CID 46882061) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[4-[2-(5-phenyl-1H-imidazol-2-yl)ethyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[2-(5-phenyl-1H-imidazol-2-yl)ethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 46882061 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[4-[2-(5-phenyl-1H-imidazol-2-yl)ethyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1ccc(CCc2ncc(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C24H20N2O2/c27-24(28)21-9-5-4-8-20(21)18-13-10-17(11-14-18)12-15-23-25-16-22(26-23)19-6-2-1-3-7-19/h1-11,13-14,16H,12,15H2,(H,25,26)(H,27,28) |
| InChIKey | MPOMHLWNVYEWLR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |