About 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine
4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine (PubChem CID 46882065) has the molecular formula C23H23N5O2
and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine |
| PubChem CID | 46882065 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine |
| SMILES | CCCOc1cccc2c1OCC(c1nc3ccc(-c4ccnc(N)n4)cc3[nH]1)C2 |
| InChI | InChI=1S/C23H23N5O2/c1-2-10-29-20-5-3-4-15-11-16(13-30-21(15)20)22-26-18-7-6-14(12-19(18)27-22)17-8-9-25-23(24)28-17/h3-9,12,16H,2,10-11,13H2,1H3,(H,26,27)(H2,24,25,28) |
| InChIKey | PEGKCAVIYOLXEP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine?
The IUPAC name of 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine (CID 46882065) is 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine.
What is the SMILES notation for 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine?
The canonical SMILES for 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine is CCCOc1cccc2c1OCC(c1nc3ccc(-c4ccnc(N)n4)cc3[nH]1)C2.
What is the InChIKey of 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine?
The InChIKey is PEGKCAVIYOLXEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N5O2/c1-2-10-29-20-5-3-4-15-11-16(13-30-21(15)20)22-26-18-7-6-14(12-19(18)27-22)17-8-9-25-23(24)28-17/h3-9,12,16H,2,10-11,13H2,1H3,(H,26,27)(H2,24,25,28).
What are the key properties of 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine?
4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine has a molecular weight of 401.47 g/mol, XLogP of 4.11, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(8-propoxy-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine is sourced from PubChem (CID 46882065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).