C12H8FN5 — CID 46882102
15-fluoro-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene (PubChem CID 46882102) has the molecular formula C12H8FN5 and a molecular weight of 241.23 g/mol. Its IUPAC name is 15-fluoro-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene.
| Compound Name | 15-fluoro-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 46882102 |
| Molecular Formula | C12H8FN5 |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 15-fluoro-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
| SMILES | Fc1ccc2c(c1)-c1ncnn1Cc1cncn1-2 |
| InChI | InChI=1S/C12H8FN5/c13-8-1-2-11-10(3-8)12-15-6-16-18(12)5-9-4-14-7-17(9)11/h1-4,6-7H,5H2 |
| InChIKey | VUYWTACIDAVGNA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |