C14H18ClNO4 — CID 46882141
(1R,4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1S)-cyclopent-2-en-1-yl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 46882141) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is (1R,4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1S)-cyclopent-2-en-1-yl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1S)-cyclopent-2-en-1-yl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 46882141 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1S)-cyclopent-2-en-1-yl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | C[C@@]12OC(=O)[C@]1([C@@H](O)[C@@H]1C=CCC1)NC(=O)[C@@H]2CCCl |
| InChI | InChI=1S/C14H18ClNO4/c1-13-9(6-7-15)11(18)16-14(13,12(19)20-13)10(17)8-4-2-3-5-8/h2,4,8-10,17H,3,5-7H2,1H3,(H,16,18)/t8-,9+,10+,13+,14+/m1/s1 |
| InChIKey | XLEUSHFPYGVEBY-PREJHDKISA-N |
| XLogP | 0.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|