C14H12ClN5O2S — CID 46882150
15-chloro-5-ethylsulfonyl-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene (PubChem CID 46882150) has the molecular formula C14H12ClN5O2S and a molecular weight of 349.80 g/mol. Its IUPAC name is 15-chloro-5-ethylsulfonyl-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene.
| Compound Name | 15-chloro-5-ethylsulfonyl-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 46882150 |
| Molecular Formula | C14H12ClN5O2S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 15-chloro-5-ethylsulfonyl-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
| SMILES | CCS(=O)(=O)c1ncn2c1Cn1ncnc1-c1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C14H12ClN5O2S/c1-2-23(21,22)14-12-6-20-13(16-7-18-20)10-5-9(15)3-4-11(10)19(12)8-17-14/h3-5,7-8H,2,6H2,1H3 |
| InChIKey | NBFQPNLHASJVCL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |