About 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane
4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane (PubChem CID 46882190) has the molecular formula C18H25N5O
and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane |
| PubChem CID | 46882190 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane |
| SMILES | C[C@H]1CCCCN1c1nc(N2CCCOCC2)c2cccnc2n1 |
| InChI | InChI=1S/C18H25N5O/c1-14-6-2-3-10-23(14)18-20-16-15(7-4-8-19-16)17(21-18)22-9-5-12-24-13-11-22/h4,7-8,14H,2-3,5-6,9-13H2,1H3/t14-/m0/s1 |
| InChIKey | QJWAJGDJASCIRF-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane?
The IUPAC name of 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane (CID 46882190) is 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane.
What is the SMILES notation for 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane?
The canonical SMILES for 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane is C[C@H]1CCCCN1c1nc(N2CCCOCC2)c2cccnc2n1.
What is the InChIKey of 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane?
The InChIKey is QJWAJGDJASCIRF-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H25N5O/c1-14-6-2-3-10-23(14)18-20-16-15(7-4-8-19-16)17(21-18)22-9-5-12-24-13-11-22/h4,7-8,14H,2-3,5-6,9-13H2,1H3/t14-/m0/s1.
What are the key properties of 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane?
4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane has a molecular weight of 327.43 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(2S)-2-methylpiperidin-1-yl]pyrido[2,3-d]pyrimidin-4-yl]-1,4-oxazepane is sourced from PubChem (CID 46882190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).