C11H19N3O5S2 — CID 46882207
(3S)-4-amino-3-[[(2S)-4-methylsulfanyl-2-[(2-sulfanylacetyl)amino]butanoyl]amino]-4-oxobutanoic acid (PubChem CID 46882207) has the molecular formula C11H19N3O5S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is (3S)-4-amino-3-[[(2S)-4-methylsulfanyl-2-[(2-sulfanylacetyl)amino]butanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-amino-3-[[(2S)-4-methylsulfanyl-2-[(2-sulfanylacetyl)amino]butanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 46882207 |
| Molecular Formula | C11H19N3O5S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (3S)-4-amino-3-[[(2S)-4-methylsulfanyl-2-[(2-sulfanylacetyl)amino]butanoyl]amino]-4-oxobutanoic acid |
| SMILES | CSCC[C@H](NC(=O)CS)C(=O)N[C@@H](CC(=O)O)C(N)=O |
| InChI | InChI=1S/C11H19N3O5S2/c1-21-3-2-6(13-8(15)5-20)11(19)14-7(10(12)18)4-9(16)17/h6-7,20H,2-5H2,1H3,(H2,12,18)(H,13,15)(H,14,19)(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | UJOWAJHFKPNLAW-BQBZGAKWSA-N |
| XLogP | -1.40 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|