About (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide
(2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide (PubChem CID 46882209) has the molecular formula C13H24N4O3S
and a molecular weight of 316.43 g/mol. Its IUPAC name is (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide |
| PubChem CID | 46882209 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)CS)C(N)=O |
| InChI | InChI=1S/C13H24N4O3S/c14-6-2-1-4-9(12(15)19)16-13(20)10-5-3-7-17(10)11(18)8-21/h9-10,21H,1-8,14H2,(H2,15,19)(H,16,20)/t9-,10-/m0/s1 |
| InChIKey | GXEJQKBDCVCORC-UWVGGRQHSA-N |
| XLogP | -0.99 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide?
The IUPAC name of (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide (CID 46882209) is (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide.
What is the SMILES notation for (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide?
The canonical SMILES for (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide is NCCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)CS)C(N)=O.
What is the InChIKey of (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide?
The InChIKey is GXEJQKBDCVCORC-UWVGGRQHSA-N. The full InChI is InChI=1S/C13H24N4O3S/c14-6-2-1-4-9(12(15)19)16-13(20)10-5-3-7-17(10)11(18)8-21/h9-10,21H,1-8,14H2,(H2,15,19)(H,16,20)/t9-,10-/m0/s1.
What are the key properties of (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide?
(2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide has a molecular weight of 316.43 g/mol, XLogP of -0.99, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-sulfanylacetyl)pyrrolidine-2-carboxamide is sourced from PubChem (CID 46882209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).