C14H13N5O — CID 46882266
15-methoxy-5-methyl-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene (PubChem CID 46882266) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 15-methoxy-5-methyl-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene.
| Compound Name | 15-methoxy-5-methyl-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 46882266 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 15-methoxy-5-methyl-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
| SMILES | COc1ccc2c(c1)-c1ncnn1Cc1c(C)ncn1-2 |
| InChI | InChI=1S/C14H13N5O/c1-9-13-6-19-14(15-7-17-19)11-5-10(20-2)3-4-12(11)18(13)8-16-9/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | JTRKASCTFFUEOZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |