About 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one
3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one (PubChem CID 46882407) has the molecular formula C18H14BrF2N3O2
and a molecular weight of 422.23 g/mol. Its IUPAC name is 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one.
Molecular Properties
| Compound Name | 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one |
| PubChem CID | 46882407 |
| Molecular Formula | C18H14BrF2N3O2 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one |
| SMILES | Cc1cnc(-n2c(C)cc(OCc3ccc(F)cc3F)c(Br)c2=O)cn1 |
| InChI | InChI=1S/C18H14BrF2N3O2/c1-10-7-23-16(8-22-10)24-11(2)5-15(17(19)18(24)25)26-9-12-3-4-13(20)6-14(12)21/h3-8H,9H2,1-2H3 |
| InChIKey | UWWQNYRFLKCMOR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one?
The IUPAC name of 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one (CID 46882407) is 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one.
What is the SMILES notation for 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one?
The canonical SMILES for 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one is Cc1cnc(-n2c(C)cc(OCc3ccc(F)cc3F)c(Br)c2=O)cn1.
What is the InChIKey of 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one?
The InChIKey is UWWQNYRFLKCMOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrF2N3O2/c1-10-7-23-16(8-22-10)24-11(2)5-15(17(19)18(24)25)26-9-12-3-4-13(20)6-14(12)21/h3-8H,9H2,1-2H3.
What are the key properties of 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one?
3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one has a molecular weight of 422.23 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-1-(5-methylpyrazin-2-yl)pyridin-2-one is sourced from PubChem (CID 46882407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).