C14H23N5O3S — CID 46882421
(2S)-2-[[(2S)-3-(1H-imidazol-5-yl)-2-[(2-sulfanylacetyl)amino]propanoyl]amino]-4-methylpentanamide (PubChem CID 46882421) has the molecular formula C14H23N5O3S and a molecular weight of 341.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-(1H-imidazol-5-yl)-2-[(2-sulfanylacetyl)amino]propanoyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2S)-3-(1H-imidazol-5-yl)-2-[(2-sulfanylacetyl)amino]propanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 46882421 |
| Molecular Formula | C14H23N5O3S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (2S)-2-[[(2S)-3-(1H-imidazol-5-yl)-2-[(2-sulfanylacetyl)amino]propanoyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CS)C(N)=O |
| InChI | InChI=1S/C14H23N5O3S/c1-8(2)3-10(13(15)21)19-14(22)11(18-12(20)6-23)4-9-5-16-7-17-9/h5,7-8,10-11,23H,3-4,6H2,1-2H3,(H2,15,21)(H,16,17)(H,18,20)(H,19,22)/t10-,11-/m0/s1 |
| InChIKey | SNJJXEIMHAVJDR-QWRGUYRKSA-N |
| XLogP | -0.62 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|