C21H28O — CID 46882436
(8S,9S,13S,14S)-3-ethenyl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 46882436) has the molecular formula C21H28O and a molecular weight of 296.45 g/mol. Its IUPAC name is (8S,9S,13S,14S)-3-ethenyl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,13S,14S)-3-ethenyl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 46882436 |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | (8S,9S,13S,14S)-3-ethenyl-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C=Cc1cc2c(cc1OC)[C@H]1CC[C@]3(C)CCC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C21H28O/c1-4-14-12-15-7-8-17-16(18(15)13-20(14)22-3)9-11-21(2)10-5-6-19(17)21/h4,12-13,16-17,19H,1,5-11H2,2-3H3/t16-,17+,19-,21-/m0/s1 |
| InChIKey | UHLTXTNFFWSHOH-NZGUISNBSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |