C22H27N3O2S — CID 46882447
1-(1,3-benzothiazol-2-ylmethyl)-N-(3-ethoxy-4-methoxyphenyl)piperidin-4-amine (PubChem CID 46882447) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)-N-(3-ethoxy-4-methoxyphenyl)piperidin-4-amine.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)-N-(3-ethoxy-4-methoxyphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 46882447 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)-N-(3-ethoxy-4-methoxyphenyl)piperidin-4-amine |
| SMILES | CCOc1cc(NC2CCN(Cc3nc4ccccc4s3)CC2)ccc1OC |
| InChI | InChI=1S/C22H27N3O2S/c1-3-27-20-14-17(8-9-19(20)26-2)23-16-10-12-25(13-11-16)15-22-24-18-6-4-5-7-21(18)28-22/h4-9,14,16,23H,3,10-13,15H2,1-2H3 |
| InChIKey | PLCWSMXIZXVZJL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|