C16H17N3O5 — CID 46882465
5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 46882465) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 46882465 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CN(C)c1nc2ccc(NC=C3C(=O)OC(C)(C)OC3=O)cc2o1 |
| InChI | InChI=1S/C16H17N3O5/c1-16(2)23-13(20)10(14(21)24-16)8-17-9-5-6-11-12(7-9)22-15(18-11)19(3)4/h5-8,17H,1-4H3 |
| InChIKey | ZXTHEPLUNGIYML-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|