C20H27NO2 — CID 46882504
(8S,9S,13S,14S)-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxamide (PubChem CID 46882504) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (8S,9S,13S,14S)-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxamide.
| Compound Name | (8S,9S,13S,14S)-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxamide |
|---|---|
| PubChem CID | 46882504 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (8S,9S,13S,14S)-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxamide |
| SMILES | COc1cc2c(cc1C(N)=O)CC[C@@H]1[C@@H]2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C20H27NO2/c1-20-8-3-4-17(20)14-6-5-12-10-16(19(21)22)18(23-2)11-15(12)13(14)7-9-20/h10-11,13-14,17H,3-9H2,1-2H3,(H2,21,22)/t13-,14+,17-,20-/m0/s1 |
| InChIKey | ZGDJPKSRBXRBSD-ACNBBOPNSA-N |
| XLogP | 4.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |