C11H9NO3 — CID 46882536
3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-9-one (PubChem CID 46882536) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-9-one.
| Compound Name | 3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-9-one |
|---|---|
| PubChem CID | 46882536 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-9-one |
| SMILES | O=c1cc[nH]c2cc3c(cc12)OCCO3 |
| InChI | InChI=1S/C11H9NO3/c13-9-1-2-12-8-6-11-10(5-7(8)9)14-3-4-15-11/h1-2,5-6H,3-4H2,(H,12,13) |
| InChIKey | BTKVXNUPTFDVLG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |