C19H27NO — CID 46882567
(8S,9S,13S,14S)-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-amine (PubChem CID 46882567) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (8S,9S,13S,14S)-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-amine.
| Compound Name | (8S,9S,13S,14S)-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 46882567 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (8S,9S,13S,14S)-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-amine |
| SMILES | COc1cc2c(cc1N)CC[C@@H]1[C@@H]2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C19H27NO/c1-19-8-3-4-16(19)14-6-5-12-10-17(20)18(21-2)11-15(12)13(14)7-9-19/h10-11,13-14,16H,3-9,20H2,1-2H3/t13-,14+,16-,19-/m0/s1 |
| InChIKey | CBFPPSWDKRHSST-MVWRLGRASA-N |
| XLogP | 4.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|