C20H29NO — CID 46882568
(8S,9S,13R,14S,17S)-2-methoxy-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-amine (PubChem CID 46882568) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (8S,9S,13R,14S,17S)-2-methoxy-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-amine.
| Compound Name | (8S,9S,13R,14S,17S)-2-methoxy-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 46882568 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (8S,9S,13R,14S,17S)-2-methoxy-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-amine |
| SMILES | COc1cc2c(cc1N)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C20H29NO/c1-12-4-7-17-15-6-5-13-10-18(21)19(22-3)11-16(13)14(15)8-9-20(12,17)2/h10-12,14-15,17H,4-9,21H2,1-3H3/t12-,14-,15+,17-,20+/m0/s1 |
| InChIKey | UQDHMRLUENFROW-HDCQOPJRSA-N |
| XLogP | 4.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|