C13H25N3O3S — CID 46882644
(2S,3R)-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-3-methyl-2-[(2-sulfanylacetyl)amino]pentanamide (PubChem CID 46882644) has the molecular formula C13H25N3O3S and a molecular weight of 303.43 g/mol. Its IUPAC name is (2S,3R)-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-3-methyl-2-[(2-sulfanylacetyl)amino]pentanamide.
| Compound Name | (2S,3R)-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-3-methyl-2-[(2-sulfanylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 46882644 |
| Molecular Formula | C13H25N3O3S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (2S,3R)-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-3-methyl-2-[(2-sulfanylacetyl)amino]pentanamide |
| SMILES | CC[C@@H](C)[C@H](NC(=O)CS)C(=O)N[C@H](C(N)=O)C(C)C |
| InChI | InChI=1S/C13H25N3O3S/c1-5-8(4)11(15-9(17)6-20)13(19)16-10(7(2)3)12(14)18/h7-8,10-11,20H,5-6H2,1-4H3,(H2,14,18)(H,15,17)(H,16,19)/t8-,10+,11+/m1/s1 |
| InChIKey | MYUHETNBYZKEGD-MIMYLULJSA-N |
| XLogP | 0.07 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|