C14H27N3O3S — CID 46882645
(2S,3R)-N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-3-methyl-2-[(2-sulfanylacetyl)amino]pentanamide (PubChem CID 46882645) has the molecular formula C14H27N3O3S and a molecular weight of 317.46 g/mol. Its IUPAC name is (2S,3R)-N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-3-methyl-2-[(2-sulfanylacetyl)amino]pentanamide.
| Compound Name | (2S,3R)-N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-3-methyl-2-[(2-sulfanylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 46882645 |
| Molecular Formula | C14H27N3O3S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (2S,3R)-N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-3-methyl-2-[(2-sulfanylacetyl)amino]pentanamide |
| SMILES | CC[C@@H](C)[C@H](NC(=O)CS)C(=O)N[C@@H](CC(C)C)C(N)=O |
| InChI | InChI=1S/C14H27N3O3S/c1-5-9(4)12(17-11(18)7-21)14(20)16-10(13(15)19)6-8(2)3/h8-10,12,21H,5-7H2,1-4H3,(H2,15,19)(H,16,20)(H,17,18)/t9-,10+,12+/m1/s1 |
| InChIKey | STOSWQQWXAYMDC-SCVCMEIPSA-N |
| XLogP | 0.46 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|