C19H25N3O3S — CID 46882764
1-hexyl-3-[4-(phenylsulfamoyl)phenyl]urea (PubChem CID 46882764) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-hexyl-3-[4-(phenylsulfamoyl)phenyl]urea.
| Compound Name | 1-hexyl-3-[4-(phenylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 46882764 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-hexyl-3-[4-(phenylsulfamoyl)phenyl]urea |
| SMILES | CCCCCCNC(=O)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-2-3-4-8-15-20-19(23)21-16-11-13-18(14-12-16)26(24,25)22-17-9-6-5-7-10-17/h5-7,9-14,22H,2-4,8,15H2,1H3,(H2,20,21,23) |
| InChIKey | ADKICSRVDIFTQJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|