C20H25F3O5S — CID 46882781
[(8R,9S,13S,14S,17S)-17-hydroxy-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate (PubChem CID 46882781) has the molecular formula C20H25F3O5S and a molecular weight of 434.48 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-17-hydroxy-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate.
| Compound Name | [(8R,9S,13S,14S,17S)-17-hydroxy-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 46882781 |
| Molecular Formula | C20H25F3O5S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-17-hydroxy-2-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] trifluoromethanesulfonate |
| SMILES | COc1cc2c(cc1OS(=O)(=O)C(F)(F)F)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C20H25F3O5S/c1-19-8-7-12-13(15(19)5-6-18(19)24)4-3-11-9-17(16(27-2)10-14(11)12)28-29(25,26)20(21,22)23/h9-10,12-13,15,18,24H,3-8H2,1-2H3/t12-,13+,15-,18-,19-/m0/s1 |
| InChIKey | HEIXVPWXEKAWEG-SSTWWWIQSA-N |
| XLogP | 4.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|