C44H58O4 — CID 46882897
benzyl (4aS,6aR,6aS,6bR,8aS,11S,12aS,14bS)-11-benzoyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 46882897) has the molecular formula C44H58O4 and a molecular weight of 650.94 g/mol. Its IUPAC name is benzyl (4aS,6aR,6aS,6bR,8aS,11S,12aS,14bS)-11-benzoyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | benzyl (4aS,6aR,6aS,6bR,8aS,11S,12aS,14bS)-11-benzoyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 46882897 |
| Molecular Formula | C44H58O4 |
| Molecular Weight | 650.94 g/mol |
| Exact Mass | 650.43 |
| IUPAC Name | benzyl (4aS,6aR,6aS,6bR,8aS,11S,12aS,14bS)-11-benzoyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | CC1(C)CC[C@]2(C(=O)OCc3ccccc3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](OC(=O)c6ccccc6)CC(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C44H58O4/c1-39(2)22-24-44(38(46)47-29-30-14-10-8-11-15-30)25-23-42(6)33(34(44)28-39)18-19-36-41(5)27-32(48-37(45)31-16-12-9-13-17-31)26-40(3,4)35(41)20-21-43(36,42)7/h8-18,32,34-36H,19-29H2,1-7H3/t32-,34-,35-,36+,41-,42+,43+,44-/m0/s1 |
| InChIKey | BBUMNXRYNLYUED-WOHWSVLASA-N |
| XLogP | 10.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.94 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|