About 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide
3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide (PubChem CID 46882917) has the molecular formula C22H26N2O
and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide |
| PubChem CID | 46882917 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide |
| SMILES | CC1(c2ccccc2)CCCN(C(=O)N[C@H]2C[C@@H]2c2ccccc2)C1 |
| InChI | InChI=1S/C22H26N2O/c1-22(18-11-6-3-7-12-18)13-8-14-24(16-22)21(25)23-20-15-19(20)17-9-4-2-5-10-17/h2-7,9-12,19-20H,8,13-16H2,1H3,(H,23,25)/t19-,20+,22?/m1/s1 |
| InChIKey | UUJAMNFWDAPMSE-MFCMXAAESA-N |
| XLogP | 4.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide?
The IUPAC name of 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide (CID 46882917) is 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide.
What is the SMILES notation for 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide?
The canonical SMILES for 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide is CC1(c2ccccc2)CCCN(C(=O)N[C@H]2C[C@@H]2c2ccccc2)C1.
What is the InChIKey of 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide?
The InChIKey is UUJAMNFWDAPMSE-MFCMXAAESA-N. The full InChI is InChI=1S/C22H26N2O/c1-22(18-11-6-3-7-12-18)13-8-14-24(16-22)21(25)23-20-15-19(20)17-9-4-2-5-10-17/h2-7,9-12,19-20H,8,13-16H2,1H3,(H,23,25)/t19-,20+,22?/m1/s1.
What are the key properties of 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide?
3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide has a molecular weight of 334.46 g/mol, XLogP of 4.31, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-phenyl-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide is sourced from PubChem (CID 46882917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).