C27H48O9 — CID 46882929
[(2S)-2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (2Z,9Z)-octadeca-2,9-dienoate (PubChem CID 46882929) has the molecular formula C27H48O9 and a molecular weight of 516.67 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (2Z,9Z)-octadeca-2,9-dienoate.
| Compound Name | [(2S)-2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (2Z,9Z)-octadeca-2,9-dienoate |
|---|---|
| PubChem CID | 46882929 |
| Molecular Formula | C27H48O9 |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | [(2S)-2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (2Z,9Z)-octadeca-2,9-dienoate |
| SMILES | CCCCCCCC/C=C\CCCCC/C=C\C(=O)OC[C@@H](O)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H48O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(30)34-19-21(29)20-35-27-26(33)25(32)24(31)22(18-28)36-27/h9-10,16-17,21-22,24-29,31-33H,2-8,11-15,18-20H2,1H3/b10-9-,17-16-/t21-,22-,24-,25+,26-,27-/m1/s1 |
| InChIKey | GGGMEAYBEYLYDS-QBICKONLSA-N |
| XLogP | 2.52 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|