About (3,5-difluorophenyl) sulfamate
(3,5-difluorophenyl) sulfamate (PubChem CID 46883000) has the molecular formula C6H5F2NO3S
and a molecular weight of 209.17 g/mol. Its IUPAC name is (3,5-difluorophenyl) sulfamate.
Molecular Properties
| Compound Name | (3,5-difluorophenyl) sulfamate |
| PubChem CID | 46883000 |
| Molecular Formula | C6H5F2NO3S |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | (3,5-difluorophenyl) sulfamate |
| SMILES | NS(=O)(=O)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C6H5F2NO3S/c7-4-1-5(8)3-6(2-4)12-13(9,10)11/h1-3H,(H2,9,10,11) |
| InChIKey | JIBXVOUHOFRVOQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,5-difluorophenyl) sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-difluorophenyl) sulfamate?
The IUPAC name of (3,5-difluorophenyl) sulfamate (CID 46883000) is (3,5-difluorophenyl) sulfamate.
What is the SMILES notation for (3,5-difluorophenyl) sulfamate?
The canonical SMILES for (3,5-difluorophenyl) sulfamate is NS(=O)(=O)Oc1cc(F)cc(F)c1.
What is the InChIKey of (3,5-difluorophenyl) sulfamate?
The InChIKey is JIBXVOUHOFRVOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F2NO3S/c7-4-1-5(8)3-6(2-4)12-13(9,10)11/h1-3H,(H2,9,10,11).
What are the key properties of (3,5-difluorophenyl) sulfamate?
(3,5-difluorophenyl) sulfamate has a molecular weight of 209.17 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-difluorophenyl) sulfamate is sourced from PubChem (CID 46883000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).