C17H24O4 — CID 46883095
(1R,4S,8S,9R,10R,12R)-4,8,10-trimethylspiro[2-oxatricyclo[6.3.1.04,12]dodecane-9,5'-oxolane]-2',3-dione (PubChem CID 46883095) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (1R,4S,8S,9R,10R,12R)-4,8,10-trimethylspiro[2-oxatricyclo[6.3.1.04,12]dodecane-9,5'-oxolane]-2',3-dione.
| Compound Name | (1R,4S,8S,9R,10R,12R)-4,8,10-trimethylspiro[2-oxatricyclo[6.3.1.04,12]dodecane-9,5'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 46883095 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1R,4S,8S,9R,10R,12R)-4,8,10-trimethylspiro[2-oxatricyclo[6.3.1.04,12]dodecane-9,5'-oxolane]-2',3-dione |
| SMILES | C[C@@H]1C[C@H]2OC(=O)[C@@]3(C)CCC[C@@](C)([C@@H]23)[C@@]12CCC(=O)O2 |
| InChI | InChI=1S/C17H24O4/c1-10-9-11-13-15(2,14(19)20-11)6-4-7-16(13,3)17(10)8-5-12(18)21-17/h10-11,13H,4-9H2,1-3H3/t10-,11-,13+,15+,16+,17-/m1/s1 |
| InChIKey | DFQREMVEHMYQMW-MZIBEIOLSA-N |
| XLogP | 2.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |