About 13,15-diepicyllenin A
13,15-diepicyllenin A (PubChem CID 46883140) has the molecular formula C20H30O5
and a molecular weight of 350.46 g/mol.
Molecular Properties
| Compound Name | 13,15-diepicyllenin A |
| PubChem CID | 46883140 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | — |
| SMILES | C[C@@H]1C[C@H]2OC(=O)[C@@]3(C)CCC[C@@](C)([C@@H]23)[C@@]12CC[C@]1(CO[C@@H](O)C1)O2 |
| InChI | InChI=1S/C20H30O5/c1-12-9-13-15-17(2,16(22)24-13)5-4-6-18(15,3)20(12)8-7-19(25-20)10-14(21)23-11-19/h12-15,21H,4-11H2,1-3H3/t12-,13-,14-,15+,17+,18+,19+,20-/m1/s1 |
| InChIKey | IACFKHAQKGTVTR-VUKVDKESSA-N |
| XLogP | 2.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 13,15-diepicyllenin A with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13,15-diepicyllenin A?
The IUPAC name of 13,15-diepicyllenin A (CID 46883140) is not available.
What is the SMILES notation for 13,15-diepicyllenin A?
The canonical SMILES for 13,15-diepicyllenin A is C[C@@H]1C[C@H]2OC(=O)[C@@]3(C)CCC[C@@](C)([C@@H]23)[C@@]12CC[C@]1(CO[C@@H](O)C1)O2.
What is the InChIKey of 13,15-diepicyllenin A?
The InChIKey is IACFKHAQKGTVTR-VUKVDKESSA-N. The full InChI is InChI=1S/C20H30O5/c1-12-9-13-15-17(2,16(22)24-13)5-4-6-18(15,3)20(12)8-7-19(25-20)10-14(21)23-11-19/h12-15,21H,4-11H2,1-3H3/t12-,13-,14-,15+,17+,18+,19+,20-/m1/s1.
What are the key properties of 13,15-diepicyllenin A?
13,15-diepicyllenin A has a molecular weight of 350.46 g/mol, XLogP of 2.79, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 13,15-diepicyllenin A is sourced from PubChem (CID 46883140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).