About CID 46883182
CID 46883182 (PubChem CID 46883182) has the molecular formula C20H28O5
and a molecular weight of 348.44 g/mol.
Molecular Properties
| Compound Name | CID 46883182 |
| PubChem CID | 46883182 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | — |
| SMILES | C[C@@H]1C[C@H]2OC(=O)[C@@]3(C)CCC[C@@](C)([C@@H]23)[C@@]12CC[C@]1(COC(=O)C1)O2 |
| InChI | InChI=1S/C20H28O5/c1-12-9-13-15-17(2,16(22)24-13)5-4-6-18(15,3)20(12)8-7-19(25-20)10-14(21)23-11-19/h12-13,15H,4-11H2,1-3H3/t12-,13-,15+,17+,18+,19+,20-/m1/s1 |
| InChIKey | UHVBVZOAJOXFRA-GBJBSKOPSA-N |
| XLogP | 3.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 46883182 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46883182?
The IUPAC name of CID 46883182 (CID 46883182) is not available.
What is the SMILES notation for CID 46883182?
The canonical SMILES for CID 46883182 is C[C@@H]1C[C@H]2OC(=O)[C@@]3(C)CCC[C@@](C)([C@@H]23)[C@@]12CC[C@]1(COC(=O)C1)O2.
What is the InChIKey of CID 46883182?
The InChIKey is UHVBVZOAJOXFRA-GBJBSKOPSA-N. The full InChI is InChI=1S/C20H28O5/c1-12-9-13-15-17(2,16(22)24-13)5-4-6-18(15,3)20(12)8-7-19(25-20)10-14(21)23-11-19/h12-13,15H,4-11H2,1-3H3/t12-,13-,15+,17+,18+,19+,20-/m1/s1.
What are the key properties of CID 46883182?
CID 46883182 has a molecular weight of 348.44 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46883182 is sourced from PubChem (CID 46883182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).