C32H27F3N4O3 — CID 46883296
N-[(1R)-1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(pyridin-3-ylmethyl)-2-(3,4,5-trifluorophenyl)acetamide (PubChem CID 46883296) has the molecular formula C32H27F3N4O3 and a molecular weight of 572.59 g/mol. Its IUPAC name is N-[(1R)-1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(pyridin-3-ylmethyl)-2-(3,4,5-trifluorophenyl)acetamide.
| Compound Name | N-[(1R)-1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(pyridin-3-ylmethyl)-2-(3,4,5-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 46883296 |
| Molecular Formula | C32H27F3N4O3 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | N-[(1R)-1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(pyridin-3-ylmethyl)-2-(3,4,5-trifluorophenyl)acetamide |
| SMILES | CCOc1ccc(-n2c([C@@H](C)N(Cc3cccnc3)C(=O)Cc3cc(F)c(F)c(F)c3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C32H27F3N4O3/c1-3-42-24-12-10-23(11-13-24)39-31(37-28-9-5-4-8-25(28)32(39)41)20(2)38(19-21-7-6-14-36-18-21)29(40)17-22-15-26(33)30(35)27(34)16-22/h4-16,18,20H,3,17,19H2,1-2H3/t20-/m1/s1 |
| InChIKey | BYEWCQUFFQUXQI-HXUWFJFHSA-N |
| XLogP | 5.93 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|