C24H30O11 — CID 46883520
[(1S,3S,4R,6S,9S)-4-methoxy-6-methyl-8-oxo-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-oxatricyclo[4.3.0.03,9]nonan-9-yl]methyl benzoate (PubChem CID 46883520) has the molecular formula C24H30O11 and a molecular weight of 494.49 g/mol. Its IUPAC name is [(1S,3S,4R,6S,9S)-4-methoxy-6-methyl-8-oxo-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-oxatricyclo[4.3.0.03,9]nonan-9-yl]methyl benzoate.
| Compound Name | [(1S,3S,4R,6S,9S)-4-methoxy-6-methyl-8-oxo-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-oxatricyclo[4.3.0.03,9]nonan-9-yl]methyl benzoate |
|---|---|
| PubChem CID | 46883520 |
| Molecular Formula | C24H30O11 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [(1S,3S,4R,6S,9S)-4-methoxy-6-methyl-8-oxo-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-oxatricyclo[4.3.0.03,9]nonan-9-yl]methyl benzoate |
| SMILES | CO[C@@H]1C[C@]2(C)OC(=O)[C@]3(COC(=O)c4ccccc4)[C@@H]1C[C@@]23O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H30O11/c1-22-9-14(31-2)13-8-24(22,34-20-18(28)17(27)16(26)15(10-25)33-20)23(13,21(30)35-22)11-32-19(29)12-6-4-3-5-7-12/h3-7,13-18,20,25-28H,8-11H2,1-2H3/t13-,14-,15-,16-,17+,18-,20+,22+,23+,24-/m1/s1 |
| InChIKey | WJLMWTMIBRKTIY-WBAMPJSPSA-N |
| XLogP | -0.86 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |