C30H28F7NO3 — CID 46883824
(1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-(4-hydroxycyclohexen-1-yl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one (PubChem CID 46883824) has the molecular formula C30H28F7NO3 and a molecular weight of 583.54 g/mol. Its IUPAC name is (1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-(4-hydroxycyclohexen-1-yl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one.
| Compound Name | (1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-(4-hydroxycyclohexen-1-yl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 46883824 |
| Molecular Formula | C30H28F7NO3 |
| Molecular Weight | 583.54 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | (1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-(4-hydroxycyclohexen-1-yl)-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
| SMILES | C[C@@H](O[C@H]1CN2C(=O)C=C(C3=CCC(O)CC3)CC2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H28F7NO3/c1-16(19-10-21(29(32,33)34)14-22(11-19)30(35,36)37)41-26-15-38-25(28(26)18-2-6-23(31)7-3-18)12-20(13-27(38)40)17-4-8-24(39)9-5-17/h2-4,6-7,10-11,13-14,16,24-26,28,39H,5,8-9,12,15H2,1H3/t16-,24?,25?,26+,28+/m1/s1 |
| InChIKey | ZAFKYFNYLKNJME-LARMGAJPSA-N |
| XLogP | 7.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.54 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |