About CID 46883909
CID 46883909 (PubChem CID 46883909) has the molecular formula C18H17FNO5PS
and a molecular weight of 409.38 g/mol.
Molecular Properties
| Compound Name | CID 46883909 |
| PubChem CID | 46883909 |
| Molecular Formula | C18H17FNO5PS |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | — |
| SMILES | O=C(N[C@@H](CO)Cc1cccc(F)c1)c1cc2ccccc2s1.O=P(=O)O |
| InChI | InChI=1S/C18H16FNO2S.HO3P/c19-14-6-3-4-12(8-14)9-15(11-21)20-18(22)17-10-13-5-1-2-7-16(13)23-17;1-4(2)3/h1-8,10,15,21H,9,11H2,(H,20,22);(H,1,2,3)/t15-;/m1./s1 |
| InChIKey | XUBIUGCAICFSAW-XFULWGLBSA-N |
| XLogP | 3.44 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 46883909 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46883909?
The IUPAC name of CID 46883909 (CID 46883909) is not available.
What is the SMILES notation for CID 46883909?
The canonical SMILES for CID 46883909 is O=C(N[C@@H](CO)Cc1cccc(F)c1)c1cc2ccccc2s1.O=P(=O)O.
What is the InChIKey of CID 46883909?
The InChIKey is XUBIUGCAICFSAW-XFULWGLBSA-N. The full InChI is InChI=1S/C18H16FNO2S.HO3P/c19-14-6-3-4-12(8-14)9-15(11-21)20-18(22)17-10-13-5-1-2-7-16(13)23-17;1-4(2)3/h1-8,10,15,21H,9,11H2,(H,20,22);(H,1,2,3)/t15-;/m1./s1.
What are the key properties of CID 46883909?
CID 46883909 has a molecular weight of 409.38 g/mol, XLogP of 3.44, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46883909 is sourced from PubChem (CID 46883909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).