C20H26N2O11S2 — CID 46884029
methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4-sulfamoylphenyl)methylamino]sulfanyloxane-2-carboxylate (PubChem CID 46884029) has the molecular formula C20H26N2O11S2 and a molecular weight of 534.57 g/mol. Its IUPAC name is methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4-sulfamoylphenyl)methylamino]sulfanyloxane-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4-sulfamoylphenyl)methylamino]sulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 46884029 |
| Molecular Formula | C20H26N2O11S2 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4-sulfamoylphenyl)methylamino]sulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](SNCc2ccc(S(N)(=O)=O)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H26N2O11S2/c1-10(23)30-15-16(31-11(2)24)18(32-12(3)25)20(33-17(15)19(26)29-4)34-22-9-13-5-7-14(8-6-13)35(21,27)28/h5-8,15-18,20,22H,9H2,1-4H3,(H2,21,27,28)/t15-,16+,17+,18-,20+/m1/s1 |
| InChIKey | KVRNIZDGWFPICM-QTVCLEQKSA-N |
| XLogP | -0.24 |
| TPSA | 186.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|