About N-(4-ethylphenyl)-N'-hydroxyhexanediamide
N-(4-ethylphenyl)-N'-hydroxyhexanediamide (PubChem CID 46884060) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(4-ethylphenyl)-N'-hydroxyhexanediamide.
Molecular Properties
| Compound Name | N-(4-ethylphenyl)-N'-hydroxyhexanediamide |
| PubChem CID | 46884060 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-(4-ethylphenyl)-N'-hydroxyhexanediamide |
| SMILES | CCc1ccc(NC(=O)CCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-2-11-7-9-12(10-8-11)15-13(17)5-3-4-6-14(18)16-19/h7-10,19H,2-6H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | OHFSXIKHOCGMKB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-ethylphenyl)-N'-hydroxyhexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethylphenyl)-N'-hydroxyhexanediamide?
The IUPAC name of N-(4-ethylphenyl)-N'-hydroxyhexanediamide (CID 46884060) is N-(4-ethylphenyl)-N'-hydroxyhexanediamide.
What is the SMILES notation for N-(4-ethylphenyl)-N'-hydroxyhexanediamide?
The canonical SMILES for N-(4-ethylphenyl)-N'-hydroxyhexanediamide is CCc1ccc(NC(=O)CCCCC(=O)NO)cc1.
What is the InChIKey of N-(4-ethylphenyl)-N'-hydroxyhexanediamide?
The InChIKey is OHFSXIKHOCGMKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-2-11-7-9-12(10-8-11)15-13(17)5-3-4-6-14(18)16-19/h7-10,19H,2-6H2,1H3,(H,15,17)(H,16,18).
What are the key properties of N-(4-ethylphenyl)-N'-hydroxyhexanediamide?
N-(4-ethylphenyl)-N'-hydroxyhexanediamide has a molecular weight of 264.32 g/mol, XLogP of 2.25, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethylphenyl)-N'-hydroxyhexanediamide is sourced from PubChem (CID 46884060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).