C20H14F3NO3 — CID 46884113
(2R)-2-(naphthalene-2-carbonylamino)-3-(3,4,5-trifluorophenyl)propanoic acid (PubChem CID 46884113) has the molecular formula C20H14F3NO3 and a molecular weight of 373.33 g/mol. Its IUPAC name is (2R)-2-(naphthalene-2-carbonylamino)-3-(3,4,5-trifluorophenyl)propanoic acid.
| Compound Name | (2R)-2-(naphthalene-2-carbonylamino)-3-(3,4,5-trifluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 46884113 |
| Molecular Formula | C20H14F3NO3 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | (2R)-2-(naphthalene-2-carbonylamino)-3-(3,4,5-trifluorophenyl)propanoic acid |
| SMILES | O=C(N[C@H](Cc1cc(F)c(F)c(F)c1)C(=O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H14F3NO3/c21-15-7-11(8-16(22)18(15)23)9-17(20(26)27)24-19(25)14-6-5-12-3-1-2-4-13(12)10-14/h1-8,10,17H,9H2,(H,24,25)(H,26,27)/t17-/m1/s1 |
| InChIKey | JGAATFACQPEKMB-QGZVFWFLSA-N |
| XLogP | 3.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|