About [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate
[(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate (PubChem CID 46884151) has the molecular formula C12H8F2N2O2S
and a molecular weight of 282.27 g/mol. Its IUPAC name is [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate.
Molecular Properties
| Compound Name | [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate |
| PubChem CID | 46884151 |
| Molecular Formula | C12H8F2N2O2S |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate |
| SMILES | C/C(=N\OC(=O)c1cc(F)ccc1F)c1nccs1 |
| InChI | InChI=1S/C12H8F2N2O2S/c1-7(11-15-4-5-19-11)16-18-12(17)9-6-8(13)2-3-10(9)14/h2-6H,1H3/b16-7+ |
| InChIKey | JHUKPHYAOBESJR-FRKPEAEDSA-N |
| XLogP | 3.00 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate?
The IUPAC name of [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate (CID 46884151) is [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate.
What is the SMILES notation for [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate?
The canonical SMILES for [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate is C/C(=N\OC(=O)c1cc(F)ccc1F)c1nccs1.
What is the InChIKey of [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate?
The InChIKey is JHUKPHYAOBESJR-FRKPEAEDSA-N. The full InChI is InChI=1S/C12H8F2N2O2S/c1-7(11-15-4-5-19-11)16-18-12(17)9-6-8(13)2-3-10(9)14/h2-6H,1H3/b16-7+.
What are the key properties of [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate?
[(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate has a molecular weight of 282.27 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] 2,5-difluorobenzoate is sourced from PubChem (CID 46884151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).