C22H23NO3 — CID 46884265
(E,2R)-5-(cyclohexen-1-yl)-2-(naphthalene-2-carbonylamino)pent-4-enoic acid (PubChem CID 46884265) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (E,2R)-5-(cyclohexen-1-yl)-2-(naphthalene-2-carbonylamino)pent-4-enoic acid.
| Compound Name | (E,2R)-5-(cyclohexen-1-yl)-2-(naphthalene-2-carbonylamino)pent-4-enoic acid |
|---|---|
| PubChem CID | 46884265 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (E,2R)-5-(cyclohexen-1-yl)-2-(naphthalene-2-carbonylamino)pent-4-enoic acid |
| SMILES | O=C(N[C@H](C/C=C/C1=CCCCC1)C(=O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H23NO3/c24-21(19-14-13-17-10-4-5-11-18(17)15-19)23-20(22(25)26)12-6-9-16-7-2-1-3-8-16/h4-7,9-11,13-15,20H,1-3,8,12H2,(H,23,24)(H,25,26)/b9-6+/t20-/m1/s1 |
| InChIKey | CVBHCSXOSPOTJO-AQDCRGGLSA-N |
| XLogP | 4.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |