About methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate
methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate (PubChem CID 46884350) has the molecular formula C15H13BO5
and a molecular weight of 284.08 g/mol. Its IUPAC name is methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate |
| PubChem CID | 46884350 |
| Molecular Formula | C15H13BO5 |
| Molecular Weight | 284.08 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate |
| SMILES | COC(=O)c1ccc(Oc2ccc3c(c2)COB3O)cc1 |
| InChI | InChI=1S/C15H13BO5/c1-19-15(17)10-2-4-12(5-3-10)21-13-6-7-14-11(8-13)9-20-16(14)18/h2-8,18H,9H2,1H3 |
| InChIKey | PABMLERDCICNNG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.08 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate?
The IUPAC name of methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate (CID 46884350) is methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate.
What is the SMILES notation for methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate?
The canonical SMILES for methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate is COC(=O)c1ccc(Oc2ccc3c(c2)COB3O)cc1.
What is the InChIKey of methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate?
The InChIKey is PABMLERDCICNNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BO5/c1-19-15(17)10-2-4-12(5-3-10)21-13-6-7-14-11(8-13)9-20-16(14)18/h2-8,18H,9H2,1H3.
What are the key properties of methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate?
methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate has a molecular weight of 284.08 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoate is sourced from PubChem (CID 46884350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).