C20H20N4OS — CID 46884360
2-(furan-2-yl)-10-thia-5,7,12-triazatetracyclo[11.7.0.03,11.04,9]icosa-1(13),2,4(9),5,7,11-hexaen-8-amine (PubChem CID 46884360) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-(furan-2-yl)-10-thia-5,7,12-triazatetracyclo[11.7.0.03,11.04,9]icosa-1(13),2,4(9),5,7,11-hexaen-8-amine.
| Compound Name | 2-(furan-2-yl)-10-thia-5,7,12-triazatetracyclo[11.7.0.03,11.04,9]icosa-1(13),2,4(9),5,7,11-hexaen-8-amine |
|---|---|
| PubChem CID | 46884360 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-(furan-2-yl)-10-thia-5,7,12-triazatetracyclo[11.7.0.03,11.04,9]icosa-1(13),2,4(9),5,7,11-hexaen-8-amine |
| SMILES | Nc1ncnc2c1sc1nc3c(c(-c4ccco4)c12)CCCCCCC3 |
| InChI | InChI=1S/C20H20N4OS/c21-19-18-17(22-11-23-19)16-15(14-9-6-10-25-14)12-7-4-2-1-3-5-8-13(12)24-20(16)26-18/h6,9-11H,1-5,7-8H2,(H2,21,22,23) |
| InChIKey | WMISFEODCMGWDV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |