C18H16N4OS — CID 46884408
10-(furan-2-yl)-18-thia-2,13,15-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,12(17),13,15-hexaen-16-amine (PubChem CID 46884408) has the molecular formula C18H16N4OS and a molecular weight of 336.42 g/mol. Its IUPAC name is 10-(furan-2-yl)-18-thia-2,13,15-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,12(17),13,15-hexaen-16-amine.
| Compound Name | 10-(furan-2-yl)-18-thia-2,13,15-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,12(17),13,15-hexaen-16-amine |
|---|---|
| PubChem CID | 46884408 |
| Molecular Formula | C18H16N4OS |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 10-(furan-2-yl)-18-thia-2,13,15-triazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,12(17),13,15-hexaen-16-amine |
| SMILES | Nc1ncnc2c1sc1nc3c(c(-c4ccco4)c12)CCCCC3 |
| InChI | InChI=1S/C18H16N4OS/c19-17-16-15(20-9-21-17)14-13(12-7-4-8-23-12)10-5-2-1-3-6-11(10)22-18(14)24-16/h4,7-9H,1-3,5-6H2,(H2,19,20,21) |
| InChIKey | JVRQFNMKPQDNAA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |