C25H33N5 — CID 46884415
3-[2-[[(4aR,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]-N,N-dimethylpropan-1-amine (PubChem CID 46884415) has the molecular formula C25H33N5 and a molecular weight of 403.57 g/mol. Its IUPAC name is 3-[2-[[(4aR,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[2-[[(4aR,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 46884415 |
| Molecular Formula | C25H33N5 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | 3-[2-[[(4aR,10bR)-3,4,4a,5,6,10b-hexahydro-2H-1,10-phenanthrolin-1-yl]methyl]benzimidazol-1-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCn1c(CN2CCC[C@H]3CCc4cccnc4[C@@H]32)nc2ccccc21 |
| InChI | InChI=1S/C25H33N5/c1-28(2)15-7-17-30-22-11-4-3-10-21(22)27-23(30)18-29-16-6-9-20-13-12-19-8-5-14-26-24(19)25(20)29/h3-5,8,10-11,14,20,25H,6-7,9,12-13,15-18H2,1-2H3/t20-,25+/m0/s1 |
| InChIKey | RIBOGSNJCBYELS-NBGIEHNGSA-N |
| XLogP | 4.28 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |