C31H26F7NO3 — CID 46884434
(1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-[4-(hydroxymethyl)phenyl]-2,3,8,8a-tetrahydro-1H-indolizin-5-one (PubChem CID 46884434) has the molecular formula C31H26F7NO3 and a molecular weight of 593.54 g/mol. Its IUPAC name is (1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-[4-(hydroxymethyl)phenyl]-2,3,8,8a-tetrahydro-1H-indolizin-5-one.
| Compound Name | (1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-[4-(hydroxymethyl)phenyl]-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 46884434 |
| Molecular Formula | C31H26F7NO3 |
| Molecular Weight | 593.54 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | (1S,2R)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-7-[4-(hydroxymethyl)phenyl]-2,3,8,8a-tetrahydro-1H-indolizin-5-one |
| SMILES | C[C@@H](O[C@H]1CN2C(=O)C=C(c3ccc(CO)cc3)CC2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H26F7NO3/c1-17(21-10-23(30(33,34)35)14-24(11-21)31(36,37)38)42-27-15-39-26(29(27)20-6-8-25(32)9-7-20)12-22(13-28(39)41)19-4-2-18(16-40)3-5-19/h2-11,13-14,17,26-27,29,40H,12,15-16H2,1H3/t17-,26?,27+,29+/m1/s1 |
| InChIKey | NJWUPRCNXYNBNF-QGYSTOEISA-N |
| XLogP | 7.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.54 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |